About CID 57238609
CID 57238609 (PubChem CID 57238609) has the molecular formula C26H22BO4
and a molecular weight of 409.27 g/mol.
Molecular Properties
| Compound Name | CID 57238609 |
| PubChem CID | 57238609 |
| Molecular Formula | C26H22BO4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | — |
| SMILES | [B](Oc1cccc(OCc2ccccc2)c1)Oc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H22BO4/c1-3-9-21(10-4-1)19-28-23-13-7-15-25(17-23)30-27-31-26-16-8-14-24(18-26)29-20-22-11-5-2-6-12-22/h1-18H,19-20H2 |
| InChIKey | LIOFCIYTQTVSQM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57238609 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57238609?
The IUPAC name of CID 57238609 (CID 57238609) is not available.
What is the SMILES notation for CID 57238609?
The canonical SMILES for CID 57238609 is [B](Oc1cccc(OCc2ccccc2)c1)Oc1cccc(OCc2ccccc2)c1.
What is the InChIKey of CID 57238609?
The InChIKey is LIOFCIYTQTVSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22BO4/c1-3-9-21(10-4-1)19-28-23-13-7-15-25(17-23)30-27-31-26-16-8-14-24(18-26)29-20-22-11-5-2-6-12-22/h1-18H,19-20H2.
What are the key properties of CID 57238609?
CID 57238609 has a molecular weight of 409.27 g/mol, XLogP of 5.84, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57238609 is sourced from PubChem (CID 57238609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).