C16H18O4 — CID 129362160
(2R)-3-(3-phenylmethoxyphenoxy)propane-1,2-diol (PubChem CID 129362160) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2R)-3-(3-phenylmethoxyphenoxy)propane-1,2-diol.
| Compound Name | (2R)-3-(3-phenylmethoxyphenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 129362160 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2R)-3-(3-phenylmethoxyphenoxy)propane-1,2-diol |
| SMILES | OC[C@@H](O)COc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H18O4/c17-10-14(18)12-20-16-8-4-7-15(9-16)19-11-13-5-2-1-3-6-13/h1-9,14,17-18H,10-12H2/t14-/m1/s1 |
| InChIKey | SRPGWEOMGJFGCQ-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |