C21H27NO5 — CID 11494508
benzyl N-[4-[3-(2,3-dihydroxypropoxy)phenyl]butyl]carbamate (PubChem CID 11494508) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is benzyl N-[4-[3-(2,3-dihydroxypropoxy)phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[3-(2,3-dihydroxypropoxy)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 11494508 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | benzyl N-[4-[3-(2,3-dihydroxypropoxy)phenyl]butyl]carbamate |
| SMILES | O=C(NCCCCc1cccc(OCC(O)CO)c1)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO5/c23-14-19(24)16-26-20-11-6-10-17(13-20)7-4-5-12-22-21(25)27-15-18-8-2-1-3-9-18/h1-3,6,8-11,13,19,23-24H,4-5,7,12,14-16H2,(H,22,25) |
| InChIKey | BEWUHNIWLODLTM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|