C16H16INO3 — CID 156619995
benzyl N-[2-(3-iodophenoxy)ethyl]carbamate (PubChem CID 156619995) has the molecular formula C16H16INO3 and a molecular weight of 397.21 g/mol. Its IUPAC name is benzyl N-[2-(3-iodophenoxy)ethyl]carbamate.
| Compound Name | benzyl N-[2-(3-iodophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 156619995 |
| Molecular Formula | C16H16INO3 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | benzyl N-[2-(3-iodophenoxy)ethyl]carbamate |
| SMILES | O=C(NCCOc1cccc(I)c1)OCc1ccccc1 |
| InChI | InChI=1S/C16H16INO3/c17-14-7-4-8-15(11-14)20-10-9-18-16(19)21-12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,18,19) |
| InChIKey | UTSXKZMNMXLLAO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|