C19H19BrF3NO3 — CID 66581924
benzyl N-[4-[3-bromo-5-(trifluoromethoxy)phenyl]butyl]carbamate (PubChem CID 66581924) has the molecular formula C19H19BrF3NO3 and a molecular weight of 446.26 g/mol. Its IUPAC name is benzyl N-[4-[3-bromo-5-(trifluoromethoxy)phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[3-bromo-5-(trifluoromethoxy)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 66581924 |
| Molecular Formula | C19H19BrF3NO3 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | benzyl N-[4-[3-bromo-5-(trifluoromethoxy)phenyl]butyl]carbamate |
| SMILES | O=C(NCCCCc1cc(Br)cc(OC(F)(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H19BrF3NO3/c20-16-10-15(11-17(12-16)27-19(21,22)23)8-4-5-9-24-18(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,10-12H,4-5,8-9,13H2,(H,24,25) |
| InChIKey | XITVGJHAXDNXQD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|