C27H20N2O2 — CID 32641017
(4S)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 32641017) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (4S)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | (4S)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 32641017 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (4S)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)[C@H](c2cccc(OCc3ccccc3)c2)C2=C(N1)c1ccccc1C2=O |
| InChI | InChI=1S/C27H20N2O2/c1-17-23(15-28)24(25-26(29-17)21-12-5-6-13-22(21)27(25)30)19-10-7-11-20(14-19)31-16-18-8-3-2-4-9-18/h2-14,24,29H,16H2,1H3/t24-/m0/s1 |
| InChIKey | SDEITIATCJVRIK-DEOSSOPVSA-N |
| XLogP | 5.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|