C21H13BrN2O2 — CID 122214245
4-(4-bromophenyl)-2-methyl-5,6-dioxo-1,4-dihydrobenzo[h]quinoline-3-carbonitrile (PubChem CID 122214245) has the molecular formula C21H13BrN2O2 and a molecular weight of 405.25 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-methyl-5,6-dioxo-1,4-dihydrobenzo[h]quinoline-3-carbonitrile.
| Compound Name | 4-(4-bromophenyl)-2-methyl-5,6-dioxo-1,4-dihydrobenzo[h]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 122214245 |
| Molecular Formula | C21H13BrN2O2 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 4-(4-bromophenyl)-2-methyl-5,6-dioxo-1,4-dihydrobenzo[h]quinoline-3-carbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc(Br)cc2)C2=C(N1)c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C21H13BrN2O2/c1-11-16(10-23)17(12-6-8-13(22)9-7-12)18-19(24-11)14-4-2-3-5-15(14)20(25)21(18)26/h2-9,17,24H,1H3 |
| InChIKey | BXAWTCILTVVBMN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|