C26H17NO3 — CID 21177329
12-(4-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene-10,14-dione (PubChem CID 21177329) has the molecular formula C26H17NO3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene-10,14-dione.
| Compound Name | 12-(4-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene-10,14-dione |
|---|---|
| PubChem CID | 21177329 |
| Molecular Formula | C26H17NO3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 12-(4-methoxyphenyl)-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene-10,14-dione |
| SMILES | COc1ccc(C2C3=C(NC4=C2C(=O)c2ccccc24)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H17NO3/c1-30-15-12-10-14(11-13-15)20-21-23(16-6-2-4-8-18(16)25(21)28)27-24-17-7-3-5-9-19(17)26(29)22(20)24/h2-13,20,27H,1H3 |
| InChIKey | LGVUEKPGQSVTOL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |