C25H20O4 — CID 158502802
12-(4-methoxyphenyl)-3,4,5,12-tetrahydro-2H-tetracene-1,6,11-trione (PubChem CID 158502802) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-3,4,5,12-tetrahydro-2H-tetracene-1,6,11-trione.
| Compound Name | 12-(4-methoxyphenyl)-3,4,5,12-tetrahydro-2H-tetracene-1,6,11-trione |
|---|---|
| PubChem CID | 158502802 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 12-(4-methoxyphenyl)-3,4,5,12-tetrahydro-2H-tetracene-1,6,11-trione |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)CC3=C2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H20O4/c1-29-16-11-9-14(10-12-16)22-21-15(5-4-8-20(21)26)13-19-23(22)25(28)18-7-3-2-6-17(18)24(19)27/h2-3,6-7,9-12,22H,4-5,8,13H2,1H3 |
| InChIKey | UUTDHYCEJREFGP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|