C30H23NO4 — CID 1326848
[4-[(10S)-9,11-dioxo-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-10-yl]phenyl] 3-methylbenzoate (PubChem CID 1326848) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is [4-[(10S)-9,11-dioxo-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-10-yl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(10S)-9,11-dioxo-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-10-yl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 1326848 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [4-[(10S)-9,11-dioxo-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinolin-10-yl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc([C@H]3C4=C(CCCC4=O)NC4=C3C(=O)c3ccccc34)cc2)c1 |
| InChI | InChI=1S/C30H23NO4/c1-17-6-4-7-19(16-17)30(34)35-20-14-12-18(13-15-20)25-26-23(10-5-11-24(26)32)31-28-21-8-2-3-9-22(21)29(33)27(25)28/h2-4,6-9,12-16,25,31H,5,10-11H2,1H3/t25-/m0/s1 |
| InChIKey | VCNMKYKOIUSGGM-VWLOTQADSA-N |
| XLogP | 5.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|