C25H23NO5 — CID 1090263
(10R)-10-(2,3,4-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 1090263) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is (10R)-10-(2,3,4-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10R)-10-(2,3,4-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 1090263 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (10R)-10-(2,3,4-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | COc1ccc([C@@H]2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)c(OC)c1OC |
| InChI | InChI=1S/C25H23NO5/c1-29-18-12-11-15(24(30-2)25(18)31-3)19-20-16(9-6-10-17(20)27)26-22-13-7-4-5-8-14(13)23(28)21(19)22/h4-5,7-8,11-12,19,26H,6,9-10H2,1-3H3/t19-/m1/s1 |
| InChIKey | GGJMUSFOFDDDQC-LJQANCHMSA-N |
| XLogP | 4.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |