C30H25NO3 — CID 51463498
(7R,10R)-7-(4-methoxyphenyl)-10-(4-methylphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 51463498) has the molecular formula C30H25NO3 and a molecular weight of 447.53 g/mol. Its IUPAC name is (7R,10R)-7-(4-methoxyphenyl)-10-(4-methylphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (7R,10R)-7-(4-methoxyphenyl)-10-(4-methylphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 51463498 |
| Molecular Formula | C30H25NO3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (7R,10R)-7-(4-methoxyphenyl)-10-(4-methylphenyl)-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC2=C(C(=O)c4ccccc42)[C@@H]3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H25NO3/c1-17-7-9-19(10-8-17)26-27-24(31-29-22-5-3-4-6-23(22)30(33)28(26)29)15-20(16-25(27)32)18-11-13-21(34-2)14-12-18/h3-14,20,26,31H,15-16H2,1-2H3/t20-,26-/m1/s1 |
| InChIKey | ODYMRBPZHOQQTA-FQRUVTKNSA-N |
| XLogP | 5.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |