C25H23NO3 — CID 1167774
(10S)-10-(3-methoxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 1167774) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (10S)-10-(3-methoxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10S)-10-(3-methoxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 1167774 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (10S)-10-(3-methoxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | COc1cccc([C@H]2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)c2ccccc23)c1 |
| InChI | InChI=1S/C25H23NO3/c1-25(2)12-18-21(19(27)13-25)20(14-7-6-8-15(11-14)29-3)22-23(26-18)16-9-4-5-10-17(16)24(22)28/h4-11,20,26H,12-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | WSVINTMFUUQPSY-FQEVSTJZSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |