C37H28N2O4S — CID 98109336
[4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] phenothiazine-10-carboxylate (PubChem CID 98109336) has the molecular formula C37H28N2O4S and a molecular weight of 596.71 g/mol. Its IUPAC name is [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] phenothiazine-10-carboxylate.
| Compound Name | [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] phenothiazine-10-carboxylate |
|---|---|
| PubChem CID | 98109336 |
| Molecular Formula | C37H28N2O4S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] phenothiazine-10-carboxylate |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3ccccc31)[C@@H]2c1ccc(OC(=O)N2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C37H28N2O4S/c1-37(2)19-25-32(28(40)20-37)31(33-34(38-25)23-9-3-4-10-24(23)35(33)41)21-15-17-22(18-16-21)43-36(42)39-26-11-5-7-13-29(26)44-30-14-8-6-12-27(30)39/h3-18,31,38H,19-20H2,1-2H3/t31-/m1/s1 |
| InChIKey | YCGGLFNWRQRLQW-WJOKGBTCSA-N |
| XLogP | 8.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |