C38H31NO4S — CID 98216510
[4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] (2R)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 98216510) has the molecular formula C38H31NO4S and a molecular weight of 597.74 g/mol. Its IUPAC name is [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] (2R)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 98216510 |
| Molecular Formula | C38H31NO4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | [4-[(10R)-7,7-dimethyl-9,11-dioxo-5,6,8,10-tetrahydroindeno[1,2-b]quinolin-10-yl]phenyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3ccccc31)[C@@H]2c1ccc(OC(=O)[C@H](Sc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H31NO4S/c1-38(2)21-29-32(30(40)22-38)31(33-34(39-29)27-15-9-10-16-28(27)35(33)41)23-17-19-25(20-18-23)43-37(42)36(24-11-5-3-6-12-24)44-26-13-7-4-8-14-26/h3-20,31,36,39H,21-22H2,1-2H3/t31-,36-/m1/s1 |
| InChIKey | WHRBZXFJYZNUBM-RRTCDKLQSA-N |
| XLogP | 8.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|