C24H21NO2 — CID 1211712
(10R)-7,7-dimethyl-10-phenyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 1211712) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (10R)-7,7-dimethyl-10-phenyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10R)-7,7-dimethyl-10-phenyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 1211712 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (10R)-7,7-dimethyl-10-phenyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3ccccc31)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C24H21NO2/c1-24(2)12-17-20(18(26)13-24)19(14-8-4-3-5-9-14)21-22(25-17)15-10-6-7-11-16(15)23(21)27/h3-11,19,25H,12-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | NRHBLGFDHIYWKL-LJQANCHMSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |