C23H19N3O3 — CID 72949924
9,9-dimethyl-6-phenyl-6,8,10,11-tetrahydropyrimido[5,4-b]acridine-5,7,12-trione (PubChem CID 72949924) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 9,9-dimethyl-6-phenyl-6,8,10,11-tetrahydropyrimido[5,4-b]acridine-5,7,12-trione.
| Compound Name | 9,9-dimethyl-6-phenyl-6,8,10,11-tetrahydropyrimido[5,4-b]acridine-5,7,12-trione |
|---|---|
| PubChem CID | 72949924 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 9,9-dimethyl-6-phenyl-6,8,10,11-tetrahydropyrimido[5,4-b]acridine-5,7,12-trione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3cncnc3C1=O)C2c1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c1-23(2)8-14-17(15(27)9-23)16(12-6-4-3-5-7-12)18-20(26-14)22(29)19-13(21(18)28)10-24-11-25-19/h3-7,10-11,16,26H,8-9H2,1-2H3 |
| InChIKey | GCBDSLVHVULEMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|