C30H29NO6 — CID 4313702
phenacyl 2-[9-(4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetate (PubChem CID 4313702) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is phenacyl 2-[9-(4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetate.
| Compound Name | phenacyl 2-[9-(4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetate |
|---|---|
| PubChem CID | 4313702 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | phenacyl 2-[9-(4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetate |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)N(CC(=O)OCC(=O)c3ccccc3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C30H29NO6/c1-36-21-15-13-20(14-16-21)28-29-22(9-5-11-24(29)32)31(23-10-6-12-25(33)30(23)28)17-27(35)37-18-26(34)19-7-3-2-4-8-19/h2-4,7-8,13-16,28H,5-6,9-12,17-18H2,1H3 |
| InChIKey | KMQNQHYMDPCWTC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |