C26H24BrNO3 — CID 42645872
10-(4-bromophenyl)-9-(4-methoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 42645872) has the molecular formula C26H24BrNO3 and a molecular weight of 478.39 g/mol. Its IUPAC name is 10-(4-bromophenyl)-9-(4-methoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-9-(4-methoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 42645872 |
| Molecular Formula | C26H24BrNO3 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 10-(4-bromophenyl)-9-(4-methoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)N(c3ccc(Br)cc3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C26H24BrNO3/c1-31-19-14-8-16(9-15-19)24-25-20(4-2-6-22(25)29)28(18-12-10-17(27)11-13-18)21-5-3-7-23(30)26(21)24/h8-15,24H,2-7H2,1H3 |
| InChIKey | BBMGKHMVBYLWEL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |