C29H26BrNO4 — CID 19616807
10-(4-bromophenyl)-9-(3-methoxy-4-prop-2-ynoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 19616807) has the molecular formula C29H26BrNO4 and a molecular weight of 532.43 g/mol. Its IUPAC name is 10-(4-bromophenyl)-9-(3-methoxy-4-prop-2-ynoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-9-(3-methoxy-4-prop-2-ynoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 19616807 |
| Molecular Formula | C29H26BrNO4 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 10-(4-bromophenyl)-9-(3-methoxy-4-prop-2-ynoxyphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | C#CCOc1ccc(C2C3=C(CCCC3=O)N(c3ccc(Br)cc3)C3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C29H26BrNO4/c1-3-16-35-25-15-10-18(17-26(25)34-2)27-28-21(6-4-8-23(28)32)31(20-13-11-19(30)12-14-20)22-7-5-9-24(33)29(22)27/h1,10-15,17,27H,4-9,16H2,2H3 |
| InChIKey | SDXWCMMHUCKSDD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|