C20H18BrN3O2 — CID 126131260
(4S)-2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 126131260) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is (4S)-2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 126131260 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (4S)-2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C#CCOc1ccc(Br)cc1[C@@H]1C(C#N)=C(N)N(C)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C20H18BrN3O2/c1-3-9-26-17-8-7-12(21)10-13(17)18-14(11-22)20(23)24(2)15-5-4-6-16(25)19(15)18/h1,7-8,10,18H,4-6,9,23H2,2H3/t18-/m1/s1 |
| InChIKey | CNSOILIMXLZULD-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|