C22H22IN3O3 — CID 126131191
(4R)-2-amino-4-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 126131191) has the molecular formula C22H22IN3O3 and a molecular weight of 503.34 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 126131191 |
| Molecular Formula | C22H22IN3O3 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | (4R)-2-amino-4-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-1-methyl-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C#CCOc1c(I)cc([C@@H]2C(C#N)=C(N)N(C)C3=C2C(=O)CCC3)cc1OCC |
| InChI | InChI=1S/C22H22IN3O3/c1-4-9-29-21-15(23)10-13(11-18(21)28-5-2)19-14(12-24)22(25)26(3)16-7-6-8-17(27)20(16)19/h1,10-11,19H,5-9,25H2,2-3H3/t19-/m1/s1 |
| InChIKey | LEJNTSMZTFREDX-LJQANCHMSA-N |
| XLogP | 3.43 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|