C16H14O2S — CID 102315074
(2R)-2-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one (PubChem CID 102315074) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2R)-2-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one.
| Compound Name | (2R)-2-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 102315074 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (2R)-2-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one |
| SMILES | COc1ccc([C@H]2CC(=O)c3ccccc3S2)cc1 |
| InChI | InChI=1S/C16H14O2S/c1-18-12-8-6-11(7-9-12)16-10-14(17)13-4-2-3-5-15(13)19-16/h2-9,16H,10H2,1H3/t16-/m1/s1 |
| InChIKey | ACMKRVIBDUVRPR-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |