C19H16O3 — CID 102247086
(2S,2aS,8aR)-2-(4-methoxyphenyl)-1,2,2a,8a-tetrahydrocyclobuta[b]naphthalene-3,8-dione (PubChem CID 102247086) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2S,2aS,8aR)-2-(4-methoxyphenyl)-1,2,2a,8a-tetrahydrocyclobuta[b]naphthalene-3,8-dione.
| Compound Name | (2S,2aS,8aR)-2-(4-methoxyphenyl)-1,2,2a,8a-tetrahydrocyclobuta[b]naphthalene-3,8-dione |
|---|---|
| PubChem CID | 102247086 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2S,2aS,8aR)-2-(4-methoxyphenyl)-1,2,2a,8a-tetrahydrocyclobuta[b]naphthalene-3,8-dione |
| SMILES | COc1ccc([C@H]2C[C@H]3C(=O)c4ccccc4C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C19H16O3/c1-22-12-8-6-11(7-9-12)15-10-16-17(15)19(21)14-5-3-2-4-13(14)18(16)20/h2-9,15-17H,10H2,1H3/t15-,16-,17+/m1/s1 |
| InChIKey | CRCJNJQLHNXXDU-ZACQAIPSSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|