C16H15NO3 — CID 94052387
(2S,3S)-3-amino-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 94052387) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S,3S)-3-amino-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3S)-3-amino-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 94052387 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S,3S)-3-amino-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc([C@@H]2Oc3ccccc3C(=O)[C@H]2N)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-19-11-8-6-10(7-9-11)16-14(17)15(18)12-4-2-3-5-13(12)20-16/h2-9,14,16H,17H2,1H3/t14-,16+/m1/s1 |
| InChIKey | CNJVYMBBVJJDME-ZBFHGGJFSA-N |
| XLogP | 2.34 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |