C23H20N2O4 — CID 7574533
(2R)-2-(4-methoxyphenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-2H-1,3-benzoxazin-4-one (PubChem CID 7574533) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R)-2-(4-methoxyphenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-2H-1,3-benzoxazin-4-one.
| Compound Name | (2R)-2-(4-methoxyphenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-2H-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 7574533 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R)-2-(4-methoxyphenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-2H-1,3-benzoxazin-4-one |
| SMILES | COc1ccc(/C=N\N2C(=O)c3ccccc3O[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O4/c1-27-18-11-7-16(8-12-18)15-24-25-22(26)20-5-3-4-6-21(20)29-23(25)17-9-13-19(28-2)14-10-17/h3-15,23H,1-2H3/b24-15-/t23-/m1/s1 |
| InChIKey | OAOLAGLUPYWHBJ-AUAXKSBWSA-N |
| XLogP | 4.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|