C20H20N2O5 — CID 10339013
[(2R,3S)-2-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-oxoazetidin-3-yl] acetate (PubChem CID 10339013) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(2R,3S)-2-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-oxoazetidin-3-yl] acetate.
| Compound Name | [(2R,3S)-2-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-oxoazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 10339013 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [(2R,3S)-2-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-oxoazetidin-3-yl] acetate |
| SMILES | COc1ccc(/C=N\N2C(=O)[C@@H](OC(C)=O)[C@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-13(23)27-19-18(15-6-10-17(26-3)11-7-15)22(20(19)24)21-12-14-4-8-16(25-2)9-5-14/h4-12,18-19H,1-3H3/b21-12-/t18-,19+/m1/s1 |
| InChIKey | UJMKXKUDTGBHBW-QSNGXNAISA-N |
| XLogP | 2.55 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|