About CID 177396976
CID 177396976 (PubChem CID 177396976) has the molecular formula C10H11O2
and a molecular weight of 163.20 g/mol.
Molecular Properties
| Compound Name | CID 177396976 |
| PubChem CID | 177396976 |
| Molecular Formula | C10H11O2 |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | — |
| SMILES | COc1ccc([CH]C(C)=O)cc1 |
| InChI | InChI=1S/C10H11O2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-7H,1-2H3 |
| InChIKey | CYCVOQSYDDOLCG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177396976 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177396976?
The IUPAC name of CID 177396976 (CID 177396976) is not available.
What is the SMILES notation for CID 177396976?
The canonical SMILES for CID 177396976 is COc1ccc([CH]C(C)=O)cc1.
What is the InChIKey of CID 177396976?
The InChIKey is CYCVOQSYDDOLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-7H,1-2H3.
What are the key properties of CID 177396976?
CID 177396976 has a molecular weight of 163.20 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177396976 is sourced from PubChem (CID 177396976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).