C19H20N2O4 — CID 10472413
(3S,4S)-3-methoxy-4-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]azetidin-2-one (PubChem CID 10472413) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3S,4S)-3-methoxy-4-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]azetidin-2-one.
| Compound Name | (3S,4S)-3-methoxy-4-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]azetidin-2-one |
|---|---|
| PubChem CID | 10472413 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3S,4S)-3-methoxy-4-(4-methoxyphenyl)-1-[(Z)-(4-methoxyphenyl)methylideneamino]azetidin-2-one |
| SMILES | COc1ccc(/C=N\N2C(=O)[C@@H](OC)[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-23-15-8-4-13(5-9-15)12-20-21-17(18(25-3)19(21)22)14-6-10-16(24-2)11-7-14/h4-12,17-18H,1-3H3/b20-12-/t17-,18-/m0/s1 |
| InChIKey | KCLYEYMTAFRQRH-AJOUPAOOSA-N |
| XLogP | 2.64 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|