C16H14O3 — CID 10777318
2-(4-hydroxyphenyl)-3-methyl-2,3-dihydrochromen-4-one (PubChem CID 10777318) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-3-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 10777318 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-methyl-2,3-dihydrochromen-4-one |
| SMILES | CC1C(=O)c2ccccc2OC1c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14O3/c1-10-15(18)13-4-2-3-5-14(13)19-16(10)11-6-8-12(17)9-7-11/h2-10,16-17H,1H3 |
| InChIKey | YMJCRRDOPPAZGA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |