C18H20NO2+ — CID 7212963
[(2S,3R)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl]-propan-2-ylazanium (PubChem CID 7212963) has the molecular formula C18H20NO2+ and a molecular weight of 282.36 g/mol. Its IUPAC name is [(2S,3R)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl]-propan-2-ylazanium.
| Compound Name | [(2S,3R)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 7212963 |
| Molecular Formula | C18H20NO2+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(2S,3R)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+][C@H]1C(=O)c2ccccc2O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-12(2)19-16-17(20)14-10-6-7-11-15(14)21-18(16)13-8-4-3-5-9-13/h3-12,16,18-19H,1-2H3/p+1/t16-,18-/m0/s1 |
| InChIKey | FRKRBLLGUGLILE-WMZOPIPTSA-O |
| XLogP | 2.34 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |