C19H22ClNO2 — CID 134106831
3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one;hydrochloride (PubChem CID 134106831) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one;hydrochloride.
| Compound Name | 3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 134106831 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one;hydrochloride |
| SMILES | CC(C)(C)NC1C(=O)c2ccccc2OC1c1ccccc1.Cl |
| InChI | InChI=1S/C19H21NO2.ClH/c1-19(2,3)20-16-17(21)14-11-7-8-12-15(14)22-18(16)13-9-5-4-6-10-13;/h4-12,16,18,20H,1-3H3;1H |
| InChIKey | KPYWOEMPWZNPIQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |