C19H21NO2 — CID 14595238
(2R,3R)-3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 14595238) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R,3R)-3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 14595238 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2R,3R)-3-(tert-butylamino)-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC(C)(C)N[C@H]1C(=O)c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c1-19(2,3)20-16-17(21)14-11-7-8-12-15(14)22-18(16)13-9-5-4-6-10-13/h4-12,16,18,20H,1-3H3/t16-,18+/m0/s1 |
| InChIKey | GVHIIIXHSQYITR-FUHWJXTLSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |