C21H15ClO2 — CID 25171057
(2R,3R)-2-(4-chlorophenyl)-3-phenyl-2,3-dihydrochromen-4-one (PubChem CID 25171057) has the molecular formula C21H15ClO2 and a molecular weight of 334.80 g/mol. Its IUPAC name is (2R,3R)-2-(4-chlorophenyl)-3-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-2-(4-chlorophenyl)-3-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 25171057 |
| Molecular Formula | C21H15ClO2 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R,3R)-2-(4-chlorophenyl)-3-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccccc2O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H15ClO2/c22-16-12-10-15(11-13-16)21-19(14-6-2-1-3-7-14)20(23)17-8-4-5-9-18(17)24-21/h1-13,19,21H/t19-,21-/m0/s1 |
| InChIKey | SSCLBEFSYWAQIT-FPOVZHCZSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |