C15H11ClO2 — CID 155678093
(2R,3R)-2-(4-chlorophenyl)-3-hydroxy-2,3-dihydroinden-1-one (PubChem CID 155678093) has the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. Its IUPAC name is (2R,3R)-2-(4-chlorophenyl)-3-hydroxy-2,3-dihydroinden-1-one.
| Compound Name | (2R,3R)-2-(4-chlorophenyl)-3-hydroxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 155678093 |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2R,3R)-2-(4-chlorophenyl)-3-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2[C@H](O)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClO2/c16-10-7-5-9(6-8-10)13-14(17)11-3-1-2-4-12(11)15(13)18/h1-8,13-14,17H/t13-,14+/m1/s1 |
| InChIKey | VWXRLBJXEHERMC-KGLIPLIRSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |