C15H10BrClO2 — CID 57332670
4-bromo-3-(4-chlorophenyl)-3,4-dihydroisochromen-1-one (PubChem CID 57332670) has the molecular formula C15H10BrClO2 and a molecular weight of 337.60 g/mol. Its IUPAC name is 4-bromo-3-(4-chlorophenyl)-3,4-dihydroisochromen-1-one.
| Compound Name | 4-bromo-3-(4-chlorophenyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 57332670 |
| Molecular Formula | C15H10BrClO2 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 4-bromo-3-(4-chlorophenyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)C(Br)c2ccccc21 |
| InChI | InChI=1S/C15H10BrClO2/c16-13-11-3-1-2-4-12(11)15(18)19-14(13)9-5-7-10(17)8-6-9/h1-8,13-14H |
| InChIKey | FGIRKWSIESGCES-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|