C21H15ClO2Se — CID 10070365
6-chloro-3-phenyl-4-phenylselanyl-3,4-dihydroisochromen-1-one (PubChem CID 10070365) has the molecular formula C21H15ClO2Se and a molecular weight of 413.76 g/mol. Its IUPAC name is 6-chloro-3-phenyl-4-phenylselanyl-3,4-dihydroisochromen-1-one.
| Compound Name | 6-chloro-3-phenyl-4-phenylselanyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 10070365 |
| Molecular Formula | C21H15ClO2Se |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 6-chloro-3-phenyl-4-phenylselanyl-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(c2ccccc2)C([Se]c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H15ClO2Se/c22-15-11-12-17-18(13-15)20(25-16-9-5-2-6-10-16)19(24-21(17)23)14-7-3-1-4-8-14/h1-13,19-20H |
| InChIKey | MDQFONQIQBBVOD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|