C15H11ClO2 — CID 129404479
(1S)-7-chloro-1-phenyl-1,4-dihydroisochromen-3-one (PubChem CID 129404479) has the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. Its IUPAC name is (1S)-7-chloro-1-phenyl-1,4-dihydroisochromen-3-one.
| Compound Name | (1S)-7-chloro-1-phenyl-1,4-dihydroisochromen-3-one |
|---|---|
| PubChem CID | 129404479 |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (1S)-7-chloro-1-phenyl-1,4-dihydroisochromen-3-one |
| SMILES | O=C1Cc2ccc(Cl)cc2[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H11ClO2/c16-12-7-6-11-8-14(17)18-15(13(11)9-12)10-4-2-1-3-5-10/h1-7,9,15H,8H2/t15-/m0/s1 |
| InChIKey | FKCTUVAFEHPFRY-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |