C17H15ClO4 — CID 59025478
7-chloro-1-(2,3-dimethoxyphenyl)-1,4-dihydroisochromen-3-one (PubChem CID 59025478) has the molecular formula C17H15ClO4 and a molecular weight of 318.76 g/mol. Its IUPAC name is 7-chloro-1-(2,3-dimethoxyphenyl)-1,4-dihydroisochromen-3-one.
| Compound Name | 7-chloro-1-(2,3-dimethoxyphenyl)-1,4-dihydroisochromen-3-one |
|---|---|
| PubChem CID | 59025478 |
| Molecular Formula | C17H15ClO4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 7-chloro-1-(2,3-dimethoxyphenyl)-1,4-dihydroisochromen-3-one |
| SMILES | COc1cccc(C2OC(=O)Cc3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C17H15ClO4/c1-20-14-5-3-4-12(17(14)21-2)16-13-9-11(18)7-6-10(13)8-15(19)22-16/h3-7,9,16H,8H2,1-2H3 |
| InChIKey | UDJIWXJHIIPVIH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |