C13H14O6 — CID 97034788
(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid (PubChem CID 97034788) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid.
| Compound Name | (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 97034788 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid |
| SMILES | COc1cccc([C@H]2OC(=O)C[C@H]2C(=O)O)c1OC |
| InChI | InChI=1S/C13H14O6/c1-17-9-5-3-4-7(12(9)18-2)11-8(13(15)16)6-10(14)19-11/h3-5,8,11H,6H2,1-2H3,(H,15,16)/t8-,11-/m1/s1 |
| InChIKey | YETPCHIJGJYLFH-LDYMZIIASA-N |
| XLogP | 1.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |