(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid

C13H14O6 — CID 97034788

IUPAC(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid
SMILESCOc1cccc([C@H]2OC(=O)C[C@H]2C(=O)O)c1OC
InChIInChI=1S/C13H14O6/c1-17-9-5-3-4-7(12(9)18-2)11-8(13(15)16)6-10(14)19-11/h3-5,8,11H,6H2,1-2H3,(H,15,16)/t8-,11-/m1/s1
InChIKeyYETPCHIJGJYLFH-LDYMZIIASA-N
MW266.25 g/mol
LogP1.39
Rot. Bonds4

About (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid

(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid (PubChem CID 97034788) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid.

Molecular Properties

Compound Name(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid
PubChem CID97034788
Molecular FormulaC13H14O6
Molecular Weight266.25 g/mol
Exact Mass266.08
IUPAC Name(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid
SMILESCOc1cccc([C@H]2OC(=O)C[C@H]2C(=O)O)c1OC
InChIInChI=1S/C13H14O6/c1-17-9-5-3-4-7(12(9)18-2)11-8(13(15)16)6-10(14)19-11/h3-5,8,11H,6H2,1-2H3,(H,15,16)/t8-,11-/m1/s1
InChIKeyYETPCHIJGJYLFH-LDYMZIIASA-N
XLogP1.39
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.25
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid?
The IUPAC name of (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid (CID 97034788) is (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid.
What is the SMILES notation for (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid?
The canonical SMILES for (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid is COc1cccc([C@H]2OC(=O)C[C@H]2C(=O)O)c1OC.
What is the InChIKey of (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid?
The InChIKey is YETPCHIJGJYLFH-LDYMZIIASA-N. The full InChI is InChI=1S/C13H14O6/c1-17-9-5-3-4-7(12(9)18-2)11-8(13(15)16)6-10(14)19-11/h3-5,8,11H,6H2,1-2H3,(H,15,16)/t8-,11-/m1/s1.
What are the key properties of (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid?
(2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid has a molecular weight of 266.25 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-(2,3-dimethoxyphenyl)-5-oxooxolane-3-carboxylic acid is sourced from PubChem (CID 97034788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).