C11H12O5 — CID 4076414
3-(2,3-dimethoxyphenyl)oxirane-2-carboxylic acid (PubChem CID 4076414) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)oxirane-2-carboxylic acid.
| Compound Name | 3-(2,3-dimethoxyphenyl)oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 4076414 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)oxirane-2-carboxylic acid |
| SMILES | COc1cccc(C2OC2C(=O)O)c1OC |
| InChI | InChI=1S/C11H12O5/c1-14-7-5-3-4-6(8(7)15-2)9-10(16-9)11(12)13/h3-5,9-10H,1-2H3,(H,12,13) |
| InChIKey | IQSMAZGCLQABEP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|