C14H19NO3 — CID 56601477
(2S,3R)-N,N-diethyl-3-(2-methoxyphenyl)oxirane-2-carboxamide (PubChem CID 56601477) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2S,3R)-N,N-diethyl-3-(2-methoxyphenyl)oxirane-2-carboxamide.
| Compound Name | (2S,3R)-N,N-diethyl-3-(2-methoxyphenyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 56601477 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2S,3R)-N,N-diethyl-3-(2-methoxyphenyl)oxirane-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1O[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C14H19NO3/c1-4-15(5-2)14(16)13-12(18-13)10-8-6-7-9-11(10)17-3/h6-9,12-13H,4-5H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | NGINYNBXASGXEO-OLZOCXBDSA-N |
| XLogP | 2.00 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|