C10H10O5 — CID 131832014
3-(4-hydroxy-3-methoxyphenyl)oxirane-2-carboxylic acid (PubChem CID 131832014) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)oxirane-2-carboxylic acid.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 131832014 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)oxirane-2-carboxylic acid |
| SMILES | COc1cc(C2OC2C(=O)O)ccc1O |
| InChI | InChI=1S/C10H10O5/c1-14-7-4-5(2-3-6(7)11)8-9(15-8)10(12)13/h2-4,8-9,11H,1H3,(H,12,13) |
| InChIKey | HXHFXTLGRUPVTB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|