C20H24O6 — CID 51723028
(2R,3S,4R,5S)-2,5-bis(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-3-ol (PubChem CID 51723028) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2,5-bis(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-3-ol.
| Compound Name | (2R,3S,4R,5S)-2,5-bis(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 51723028 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2R,3S,4R,5S)-2,5-bis(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-3-ol |
| SMILES | COc1cc([C@H]2O[C@H](c3ccc(O)c(OC)c3)[C@@](C)(O)[C@@H]2C)ccc1O |
| InChI | InChI=1S/C20H24O6/c1-11-18(12-5-7-14(21)16(9-12)24-3)26-19(20(11,2)23)13-6-8-15(22)17(10-13)25-4/h5-11,18-19,21-23H,1-4H3/t11-,18+,19-,20+/m1/s1 |
| InChIKey | DGYASNDHNSXGSL-BSWYJSDQSA-N |
| XLogP | 3.31 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |