C20H22O7 — CID 163028163
5-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxybenzene-1,2-diol (PubChem CID 163028163) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 5-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 163028163 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc([C@H]2OC[C@H]3[C@@H]2CO[C@@H]3c2cc(O)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H22O7/c1-24-16-6-10(3-4-14(16)21)19-12-8-27-20(13(12)9-26-19)11-5-15(22)18(23)17(7-11)25-2/h3-7,12-13,19-23H,8-9H2,1-2H3/t12-,13-,19+,20+/m0/s1 |
| InChIKey | BAMUCOAOGMYNQY-ISZNXKAUSA-N |
| XLogP | 2.90 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|