C20H22O9S — CID 162817191
[4-[3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenyl] hydrogen sulfate (PubChem CID 162817191) has the molecular formula C20H22O9S and a molecular weight of 438.45 g/mol. Its IUPAC name is [4-[3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenyl] hydrogen sulfate.
| Compound Name | [4-[3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 162817191 |
| Molecular Formula | C20H22O9S |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [4-[3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenyl] hydrogen sulfate |
| SMILES | COc1cc(C2OCC3C(c4ccc(OS(=O)(=O)O)c(OC)c4)OCC23)ccc1O |
| InChI | InChI=1S/C20H22O9S/c1-25-17-7-11(3-5-15(17)21)19-13-9-28-20(14(13)10-27-19)12-4-6-16(18(8-12)26-2)29-30(22,23)24/h3-8,13-14,19-21H,9-10H2,1-2H3,(H,22,23,24) |
| InChIKey | ODEQQZORHQBZKE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|