C19H18O7 — CID 162994857
(3S,3aS,6S,6aR)-3-(3,4-dihydroxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one (PubChem CID 162994857) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is (3S,3aS,6S,6aR)-3-(3,4-dihydroxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one.
| Compound Name | (3S,3aS,6S,6aR)-3-(3,4-dihydroxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |
|---|---|
| PubChem CID | 162994857 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3S,3aS,6S,6aR)-3-(3,4-dihydroxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |
| SMILES | COc1cc([C@H]2OC(=O)[C@H]3[C@@H]2CO[C@@H]3c2ccc(O)c(O)c2)ccc1O |
| InChI | InChI=1S/C19H18O7/c1-24-15-7-10(3-5-13(15)21)17-11-8-25-18(16(11)19(23)26-17)9-2-4-12(20)14(22)6-9/h2-7,11,16-18,20-22H,8H2,1H3/t11-,16-,17+,18+/m0/s1 |
| InChIKey | OMXJYLMRFQOOKU-ZUHTVMMCSA-N |
| XLogP | 2.41 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|