C24H28O9 — CID 162983447
(3S,3aS,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one (PubChem CID 162983447) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is (3S,3aS,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one.
| Compound Name | (3S,3aS,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |
|---|---|
| PubChem CID | 162983447 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (3S,3aS,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |
| SMILES | COc1cc([C@H]2OC[C@H]3[C@@H]2C(=O)O[C@H]3c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28O9/c1-26-15-7-12(8-16(27-2)22(15)30-5)20-14-11-32-21(19(14)24(25)33-20)13-9-17(28-3)23(31-6)18(10-13)29-4/h7-10,14,19-21H,11H2,1-6H3/t14-,19-,20-,21+/m0/s1 |
| InChIKey | FOHDLKIPCXMQAD-FXLVCCLPSA-N |
| XLogP | 3.34 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |