C26H34O10 — CID 11755912
(1S,4aS,5S,8aS)-1,5-bis(3,4,5-trimethoxyphenyl)-1,3,4,4a,5,7,8,8a-octahydropyrano[4,3-c]pyran-3,7-diol (PubChem CID 11755912) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is (1S,4aS,5S,8aS)-1,5-bis(3,4,5-trimethoxyphenyl)-1,3,4,4a,5,7,8,8a-octahydropyrano[4,3-c]pyran-3,7-diol.
| Compound Name | (1S,4aS,5S,8aS)-1,5-bis(3,4,5-trimethoxyphenyl)-1,3,4,4a,5,7,8,8a-octahydropyrano[4,3-c]pyran-3,7-diol |
|---|---|
| PubChem CID | 11755912 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (1S,4aS,5S,8aS)-1,5-bis(3,4,5-trimethoxyphenyl)-1,3,4,4a,5,7,8,8a-octahydropyrano[4,3-c]pyran-3,7-diol |
| SMILES | COc1cc([C@H]2OC(O)C[C@H]3[C@@H]2CC(O)O[C@@H]3c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H34O10/c1-29-17-7-13(8-18(30-2)25(17)33-5)23-15-11-22(28)36-24(16(15)12-21(27)35-23)14-9-19(31-3)26(34-6)20(10-14)32-4/h7-10,15-16,21-24,27-28H,11-12H2,1-6H3/t15-,16-,21?,22?,23+,24+/m0/s1 |
| InChIKey | JJCULEVCPBVWJE-VSRONTLPSA-N |
| XLogP | 3.23 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |