C14H18O4 — CID 122393732
(1S,4R)-4-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-ol (PubChem CID 122393732) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1S,4R)-4-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 122393732 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1S,4R)-4-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-ol |
| SMILES | COc1cc([C@H]2C=C[C@@H](O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C14H18O4/c1-16-12-7-10(9-4-5-11(15)6-9)8-13(17-2)14(12)18-3/h4-5,7-9,11,15H,6H2,1-3H3/t9-,11+/m0/s1 |
| InChIKey | DOFLIKJVIDAJRS-GXSJLCMTSA-N |
| XLogP | 2.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|